CAS 7069-42-3 appears in our catalog under these names: (2E,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-yl propionate, 98% (stabilized with BHT), Retinyl Propionate (Stabilized with BHT) 90%, Retinyl Propionate, Retinyl propionate, RETINYL PROPIONATE >= 98.0% (HPLC, &. Offered by: AmBeed, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 500mg, 5g, 25g, 10g, 50g, 100g, 250g.
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate (CAS 7069-42-3) is a chemical compound with the molecular formula C23H34O2 and a molecular weight of 342.5 g/mol. IUPAC name: [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate. InChIKey: SFRPDSKECHTFQA-ONOWFSFQSA-N.
| Molecular formula | C23H34O2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate |
| InChIKey | SFRPDSKECHTFQA-ONOWFSFQSA-N |
| SMILES | CCC(=O)OC/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)