CAS 1242077-07-1 is the registry number for 2,6-Bis(trimethylstannyl)benzo[1,2-b:4,5-b']dithiophene, 99%(LC-MS),RG, 99%(LC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Trimethyl-(2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl)stannane (CAS 1242077-07-1) is a chemical compound with the molecular formula C16H22S2Sn2 and a molecular weight of 515.9 g/mol. IUPAC name: trimethyl-(2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl)stannane. InChIKey: NSJUTGAFHWENGR-UHFFFAOYSA-N.
| Molecular formula | C16H22S2Sn2 |
|---|---|
| Molecular weight | 515.9 g/mol |
| IUPAC name | trimethyl-(2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl)stannane |
| InChIKey | NSJUTGAFHWENGR-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1=CC2=CC3=C(C=C2S1)C=C(S3)[Sn](C)(C)C |
Computed by PubChem (NCBI)