CAS 1610057-24-3 appears in our catalog under these names: 1,2-Bis(5-(trimethylstannyl)thiophen-2-yl)ethyne, 95%, 1,2–Bis(5–(trimethylstannyl)thiophen–2–yl)ethyne. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 250mg.
Trimethyl-[5-[2-(5-trimethylstannylthiophen-2-yl)ethynyl]thiophen-2-yl]stannane (CAS 1610057-24-3) is a chemical compound with the molecular formula C16H22S2Sn2 and a molecular weight of 515.9 g/mol. IUPAC name: trimethyl-[5-[2-(5-trimethylstannylthiophen-2-yl)ethynyl]thiophen-2-yl]stannane. InChIKey: FIYYYDYAOSAXOH-UHFFFAOYSA-N.
| Molecular formula | C16H22S2Sn2 |
|---|---|
| Molecular weight | 515.9 g/mol |
| IUPAC name | trimethyl-[5-[2-(5-trimethylstannylthiophen-2-yl)ethynyl]thiophen-2-yl]stannane |
| InChIKey | FIYYYDYAOSAXOH-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1=CC=C(S1)C#CC2=CC=C(S2)[Sn](C)(C)C |
Computed by PubChem (NCBI)