CAS 1242077-24-2 appears in our catalog under these names: 2,6-Dibromobenzo(1,2-b:5,4-b')dithiophene, 98%, 2,6–Dibromobenzo(1,2–b:5,4–b')dithiophene, 2,6-Dibromobenzo[1,2-b:5,4-b']dithiophene, >98.0%(GC), 2,6-Dibromobenzo[1,2-b:5,4-b']dithiophene, 98%, 98%, 2,6-Dibromobenzo[1,2-b:5,4-b']dithiophene, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg.
2,6-dibromothieno[3,2-f][1]benzothiole (CAS 1242077-24-2) is a chemical compound with the molecular formula C10H4Br2S2 and a molecular weight of 348.1 g/mol. IUPAC name: 2,6-dibromothieno[3,2-f][1]benzothiole. InChIKey: PZJRHIYHVCHULC-UHFFFAOYSA-N.
| Molecular formula | C10H4Br2S2 |
|---|---|
| Molecular weight | 348.1 g/mol |
| IUPAC name | 2,6-dibromothieno[3,2-f][1]benzothiole |
| InChIKey | PZJRHIYHVCHULC-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(SC2=CC3=C1C=C(S3)Br)Br |
Computed by PubChem (NCBI)