CAS 909280-97-3 appears in our catalog under these names: 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene, 95%, 2,6–Dibromobenzo(1,2–b:4,5–b')dithiophene, 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene, >98.0%(GC), 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene, 98% (stabilized with Cu+HQ+MgO), 98% (stabilized with Cu+HQ+MgO), 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene, 98% (stabilized with Cu+HQ+MgO). Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,6-dibromothieno[2,3-f][1]benzothiole (CAS 909280-97-3) is a chemical compound with the molecular formula C10H4Br2S2 and a molecular weight of 348.1 g/mol. IUPAC name: 2,6-dibromothieno[2,3-f][1]benzothiole. InChIKey: SXRSYJAHJIIXFM-UHFFFAOYSA-N.
| Molecular formula | C10H4Br2S2 |
|---|---|
| Molecular weight | 348.1 g/mol |
| IUPAC name | 2,6-dibromothieno[2,3-f][1]benzothiole |
| InChIKey | SXRSYJAHJIIXFM-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(SC2=CC3=C1SC(=C3)Br)Br |
Computed by PubChem (NCBI)