Products 1242166-68-2
CAS 1242166-68-2 is the registry number for rac-(3R,4S)-4-Phenylpyrrolidin-3-ol, trans. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(3S,4R)-4-phenylpyrrolidin-3-ol (CAS 1242166-68-2) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (3S,4R)-4-phenylpyrrolidin-3-ol. InChIKey: LKWOEDBCCDPEQB-VHSXEESVSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (3S,4R)-4-phenylpyrrolidin-3-ol |
| InChIKey | LKWOEDBCCDPEQB-VHSXEESVSA-N |
| SMILES | C1[C@H]([C@@H](CN1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)