Products 1242267-76-0

CAS 1242267-76-0 is the registry number for Ethyl 2-(3-(aminomethyl)oxetan-3-yl)acetate oxalate, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Ethyl 2-[3-(aminomethyl)oxetan-3-yl]acetate;oxalic acid (CAS 1242267-76-0) is a chemical compound with the molecular formula C10H17NO7 and a molecular weight of 263.24 g/mol. IUPAC name: ethyl 2-[3-(aminomethyl)oxetan-3-yl]acetate;oxalic acid. InChIKey: XNCQEIAVFDGDQA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO7
Molecular weight263.24 g/mol
IUPAC nameethyl 2-[3-(aminomethyl)oxetan-3-yl]acetate;oxalic acid
InChIKeyXNCQEIAVFDGDQA-UHFFFAOYSA-N
SMILESCCOC(=O)CC1(COC1)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)