CAS 284045-95-0 is the registry number for 5-Amino-3-O(-D-xylopyranosyl)-D-threo-pentano-1,5-lactam. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg.
(3S,4R)-3-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one (CAS 284045-95-0) is a chemical compound with the molecular formula C10H17NO7 and a molecular weight of 263.24 g/mol. IUPAC name: (3S,4R)-3-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one. InChIKey: BHZMHPRIYUPDCT-BQWZOORQSA-N.
| Molecular formula | C10H17NO7 |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | (3S,4R)-3-hydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one |
| InChIKey | BHZMHPRIYUPDCT-BQWZOORQSA-N |
| SMILES | C1CNC(=O)[C@H]([C@@H]1O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O |
Computed by PubChem (NCBI)