CAS 1242267-93-1 is the registry number for 4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-1h-pyrazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-5-amine (CAS 1242267-93-1) is a chemical compound with the molecular formula C9H6ClF3N4 and a molecular weight of 262.62 g/mol. IUPAC name: 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-5-amine. InChIKey: FRFXHXOPUYDYOD-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3N4 |
|---|---|
| Molecular weight | 262.62 g/mol |
| IUPAC name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-5-amine |
| InChIKey | FRFXHXOPUYDYOD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C2=C(NN=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)