CAS 1431965-28-4 is the registry number for 3-Chloro-1-(5-(trifluoromethyl)pyridin-2-yl)-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine (CAS 1431965-28-4) is a chemical compound with the molecular formula C9H6ClF3N4 and a molecular weight of 262.62 g/mol. IUPAC name: 3-chloro-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine. InChIKey: WGARDNDCOHLAHK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3N4 |
|---|---|
| Molecular weight | 262.62 g/mol |
| IUPAC name | 3-chloro-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine |
| InChIKey | WGARDNDCOHLAHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)N2C=C(C(=N2)Cl)N |
Computed by PubChem (NCBI)