CAS 1242268-19-4 is the registry number for 6-Bromo-n-(2,2-dimethylpropyl)pyridine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-N-(2,2-dimethylpropyl)pyridine-3-carboxamide (CAS 1242268-19-4) is a chemical compound with the molecular formula C11H15BrN2O and a molecular weight of 271.15 g/mol. IUPAC name: 6-bromo-N-(2,2-dimethylpropyl)pyridine-3-carboxamide. InChIKey: HEAHOFMAKWSCTD-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | 6-bromo-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |
| InChIKey | HEAHOFMAKWSCTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC(=O)C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)