CAS 1504448-31-0 is the registry number for 1-(4-Bromo-2-ethylphenyl)-3,3-dimethylurea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-bromo-2-ethylphenyl)-1,1-dimethylurea (CAS 1504448-31-0) is a chemical compound with the molecular formula C11H15BrN2O and a molecular weight of 271.15 g/mol. IUPAC name: 3-(4-bromo-2-ethylphenyl)-1,1-dimethylurea. InChIKey: PHVDYCNWKAQCKZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | 3-(4-bromo-2-ethylphenyl)-1,1-dimethylurea |
| InChIKey | PHVDYCNWKAQCKZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Br)NC(=O)N(C)C |
Computed by PubChem (NCBI)