CAS 2387600-42-0 is the registry number for tert-Butyl 2-(aminomethyl)-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(aminomethyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate (CAS 2387600-42-0) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: tert-butyl 2-(aminomethyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate. InChIKey: QYAFGUGNPLFMAZ-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | tert-butyl 2-(aminomethyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| InChIKey | QYAFGUGNPLFMAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)SC(=N2)CN |
Computed by PubChem (NCBI)