Products 124242-84-8
CAS 124242-84-8 is the registry number for 4-(3-(Piperidin-1-yl)propanoyl)benzoic acid hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-piperidin-1-ylpropanoyl)benzoic acid;hydrochloride (CAS 124242-84-8) is a chemical compound with the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. IUPAC name: 4-(3-piperidin-1-ylpropanoyl)benzoic acid;hydrochloride. InChIKey: QZAZDSMMWNITLV-UHFFFAOYSA-N.
| Molecular formula | C15H20ClNO3 |
|---|---|
| Molecular weight | 297.78 g/mol |
| IUPAC name | 4-(3-piperidin-1-ylpropanoyl)benzoic acid;hydrochloride |
| InChIKey | QZAZDSMMWNITLV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCC(=O)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)