CAS 52467-54-6 appears in our catalog under these names: Z-Leu-chloromethylketone, 95%, Z–Leu–chloromethylketone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 5g.
Benzyl N-[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]carbamate (CAS 52467-54-6) is a chemical compound with the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. IUPAC name: benzyl N-[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]carbamate. InChIKey: FZWQHSCPNKTIRU-ZDUSSCGKSA-N.
| Molecular formula | C15H20ClNO3 |
|---|---|
| Molecular weight | 297.78 g/mol |
| IUPAC name | benzyl N-[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]carbamate |
| InChIKey | FZWQHSCPNKTIRU-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)CCl)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)