Products 1242674-90-3
CAS 1242674-90-3 is the registry number for tert-butyl allyl(2,6-dichloropyrimidin-4-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
Tert-butyl N-(2,6-dichloropyrimidin-4-yl)-N-prop-2-enylcarbamate (CAS 1242674-90-3) is a chemical compound with the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.17 g/mol. IUPAC name: tert-butyl N-(2,6-dichloropyrimidin-4-yl)-N-prop-2-enylcarbamate. InChIKey: BDYTVXGELQRLFX-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O2 |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | tert-butyl N-(2,6-dichloropyrimidin-4-yl)-N-prop-2-enylcarbamate |
| InChIKey | BDYTVXGELQRLFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC=C)C1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)