CAS 2306261-20-9 is the registry number for tert-Butyl 3-(3,6-dichloropyridazin-4-yl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(3,6-dichloropyridazin-4-yl)azetidine-1-carboxylate (CAS 2306261-20-9) is a chemical compound with the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.17 g/mol. IUPAC name: tert-butyl 3-(3,6-dichloropyridazin-4-yl)azetidine-1-carboxylate. InChIKey: FTFLYBBLWVPWGX-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O2 |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | tert-butyl 3-(3,6-dichloropyridazin-4-yl)azetidine-1-carboxylate |
| InChIKey | FTFLYBBLWVPWGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)