Products 1242770-19-9
CAS 1242770-19-9 appears in our catalog under these names: 2-(4-(tert-Butyl)benzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(4-(tert-Butyl)benzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(4-tert-butylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1242770-19-9) is a chemical compound with the molecular formula C17H27BO2 and a molecular weight of 274.2 g/mol. IUPAC name: 2-[(4-tert-butylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WWNKIIWXTUXZJD-UHFFFAOYSA-N.
| Molecular formula | C17H27BO2 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 2-[(4-tert-butylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WWNKIIWXTUXZJD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)