CAS 2648451-28-7 is the registry number for 4,4,5,5-Tetramethyl-2-(4-neopentylphenyl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(2,2-dimethylpropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2648451-28-7) is a chemical compound with the molecular formula C17H27BO2 and a molecular weight of 274.2 g/mol. IUPAC name: 2-[4-(2,2-dimethylpropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FAQQJXRTCJUIQZ-UHFFFAOYSA-N.
| Molecular formula | C17H27BO2 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 2-[4-(2,2-dimethylpropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FAQQJXRTCJUIQZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(C)(C)C |
Computed by PubChem (NCBI)