Products 1242893-25-9
CAS 1242893-25-9 is the registry number for Ethyl 2-(1H-pyrrol-1-yl)-4-(trifluoromethyl)thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-pyrrol-1-yl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS 1242893-25-9) is a chemical compound with the molecular formula C11H9F3N2O2S and a molecular weight of 290.26 g/mol. IUPAC name: ethyl 2-pyrrol-1-yl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate. InChIKey: MKLRAIYBRPAYLU-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O2S |
|---|---|
| Molecular weight | 290.26 g/mol |
| IUPAC name | ethyl 2-pyrrol-1-yl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| InChIKey | MKLRAIYBRPAYLU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N2C=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)