CAS 1350351-93-7 is the registry number for (5–(4–Methoxy–2–trifluoromethylphenyl)–(1,3,4)thiadiazol–2–yl)–methanol. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
[5-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methanol (CAS 1350351-93-7) is a chemical compound with the molecular formula C11H9F3N2O2S and a molecular weight of 290.26 g/mol. IUPAC name: [5-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methanol. InChIKey: ZYLAHJRPFBJGDC-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O2S |
|---|---|
| Molecular weight | 290.26 g/mol |
| IUPAC name | [5-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methanol |
| InChIKey | ZYLAHJRPFBJGDC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NN=C(S2)CO)C(F)(F)F |
Computed by PubChem (NCBI)