CAS 1243029-84-6 is the registry number for 5-Ethyl-3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-d][1,2,4]triazin-8(7H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethyl-3-(4-fluorophenyl)-7H-[1,2,4]triazolo[4,3-d][1,2,4]triazin-8-one (CAS 1243029-84-6) is a chemical compound with the molecular formula C12H10FN5O and a molecular weight of 259.24 g/mol. IUPAC name: 5-ethyl-3-(4-fluorophenyl)-7H-[1,2,4]triazolo[4,3-d][1,2,4]triazin-8-one. InChIKey: UQOFJBCUALNSAC-UHFFFAOYSA-N.
| Molecular formula | C12H10FN5O |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | 5-ethyl-3-(4-fluorophenyl)-7H-[1,2,4]triazolo[4,3-d][1,2,4]triazin-8-one |
| InChIKey | UQOFJBCUALNSAC-UHFFFAOYSA-N |
| SMILES | CCC1=NNC(=O)C2=NN=C(N12)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)