CAS 2007915-48-0 is the registry number for 5-(5-Fluoro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-(5-fluoro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (CAS 2007915-48-0) is a chemical compound with the molecular formula C12H10FN5O and a molecular weight of 259.24 g/mol. IUPAC name: 5-(5-fluoro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine. InChIKey: GYEAUQZXFVDIMA-UHFFFAOYSA-N.
| Molecular formula | C12H10FN5O |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | 5-(5-fluoro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| InChIKey | GYEAUQZXFVDIMA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C2=CN=CC3=NC(=NN23)N |
Computed by PubChem (NCBI)