CAS 1243047-46-2 is the registry number for Methyl 5-fluoro-1-methyl-3-(1H-pyrrol-1-yl)-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.
Methyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate (CAS 1243047-46-2) is a chemical compound with the molecular formula C15H13FN2O2 and a molecular weight of 272.27 g/mol. IUPAC name: methyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate. InChIKey: FOIIXTBQBRWHHI-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2O2 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | methyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate |
| InChIKey | FOIIXTBQBRWHHI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)C(=C1C(=O)OC)N3C=CC=C3 |
Computed by PubChem (NCBI)