Products 1243047-46-2

CAS 1243047-46-2 is the registry number for Methyl 5-fluoro-1-methyl-3-(1H-pyrrol-1-yl)-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

Methyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate (CAS 1243047-46-2) is a chemical compound with the molecular formula C15H13FN2O2 and a molecular weight of 272.27 g/mol. IUPAC name: methyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate. InChIKey: FOIIXTBQBRWHHI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13FN2O2
Molecular weight272.27 g/mol
IUPAC namemethyl 5-fluoro-1-methyl-3-pyrrol-1-ylindole-2-carboxylate
InChIKeyFOIIXTBQBRWHHI-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)F)C(=C1C(=O)OC)N3C=CC=C3

Computed by PubChem (NCBI)