CAS 1550409-79-4 is the registry number for 2-(3,4-Dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridine (CAS 1550409-79-4) is a chemical compound with the molecular formula C15H13FN2O2 and a molecular weight of 272.27 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridine. InChIKey: CGSFUQNEOSBUJI-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2O2 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridine |
| InChIKey | CGSFUQNEOSBUJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C=C(C=CC3=N2)F)OC |
Computed by PubChem (NCBI)