CAS 1243062-50-1 appears in our catalog under these names: (2S)-(([(4-Methyl-2-oxo-2h-chromen-7-yl)oxy]acetyl)amino)(phenyl)acetic acid, 95%, (2S)-({((4-Methyl-2-oxo-2H-chromen-7-yl)oxy)acetyl}amino)(phenyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 2g, 5g.
(2S)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-2-phenylacetic acid (CAS 1243062-50-1) is a chemical compound with the molecular formula C20H17NO6 and a molecular weight of 367.4 g/mol. IUPAC name: (2S)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-2-phenylacetic acid. InChIKey: FLFMAUXSEZIPNJ-IBGZPJMESA-N.
| Molecular formula | C20H17NO6 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-2-phenylacetic acid |
| InChIKey | FLFMAUXSEZIPNJ-IBGZPJMESA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC(=O)N[C@@H](C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)