CAS 88784-33-2 appears in our catalog under these names: (S)–5–(Benzyloxy)–2–(1,3–dioxoisoindolin–2–yl)–5–oxopentanoic acid, (S)-5-(Benzyloxy)-2-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic acid, 95%, 5-(Phenylmethyl) (2S)-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)pentanedioate, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-2-(1,3-dioxoisoindol-2-yl)-5-oxo-5-phenylmethoxypentanoic acid (CAS 88784-33-2) is a chemical compound with the molecular formula C20H17NO6 and a molecular weight of 367.4 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: MQUZTINHMZQECR-INIZCTEOSA-N.
| Molecular formula | C20H17NO6 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | MQUZTINHMZQECR-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)O)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)