Products 1243388-16-0
CAS 1243388-16-0 is the registry number for 2-Chloro-5-hydroxy-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-5-hydroxy-N,N-dimethylbenzamide (CAS 1243388-16-0) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-chloro-5-hydroxy-N,N-dimethylbenzamide. InChIKey: BHMRRMWPBWOARJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-chloro-5-hydroxy-N,N-dimethylbenzamide |
| InChIKey | BHMRRMWPBWOARJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)O)Cl |
Computed by PubChem (NCBI)