CAS 1243401-15-1 is the registry number for 3-Fluoro-5-hydroxy-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-fluoro-5-hydroxy-N,N-dimethylbenzamide (CAS 1243401-15-1) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-fluoro-5-hydroxy-N,N-dimethylbenzamide. InChIKey: FIWFGOPXACITLQ-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-fluoro-5-hydroxy-N,N-dimethylbenzamide |
| InChIKey | FIWFGOPXACITLQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)F)O |
Computed by PubChem (NCBI)