CAS 1243419-67-1 appears in our catalog under these names: 6-Bromo-3-chloro-2-methyl-2h-indazole, 95%, 6-Bromo-3-chloro-2-methyl-2H-indazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g.
6-bromo-3-chloro-2-methylindazole (CAS 1243419-67-1) is a chemical compound with the molecular formula C8H6BrClN2 and a molecular weight of 245.50 g/mol. IUPAC name: 6-bromo-3-chloro-2-methylindazole. InChIKey: GTEXMOAFZRRHAA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2 |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 6-bromo-3-chloro-2-methylindazole |
| InChIKey | GTEXMOAFZRRHAA-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=CC(=CC2=N1)Br)Cl |
Computed by PubChem (NCBI)