CAS 16429-40-6 appears in our catalog under these names: 5-Bromo-7-chloro-2-methyl-1h-1,3-benzimidazole, 95%, 6-Bromo-4-chloro-2-methyl-1H-benzo[d]imidazole 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g.
6-bromo-4-chloro-2-methyl-1H-benzimidazole (CAS 16429-40-6) is a chemical compound with the molecular formula C8H6BrClN2 and a molecular weight of 245.50 g/mol. IUPAC name: 6-bromo-4-chloro-2-methyl-1H-benzimidazole. InChIKey: GKVOLHHLAUQFCN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2 |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 6-bromo-4-chloro-2-methyl-1H-benzimidazole |
| InChIKey | GKVOLHHLAUQFCN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)