Products 1243603-61-3

CAS 1243603-61-3 is the registry number for V-ATPase-IN-1, 99.23%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]aniline (CAS 1243603-61-3) is a chemical compound with the molecular formula C21H20ClNO2 and a molecular weight of 353.8 g/mol. IUPAC name: N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]aniline. InChIKey: OWIHKEZYFBVCNY-UHFFFAOYSA-N.

Identity
Molecular formulaC21H20ClNO2
Molecular weight353.8 g/mol
IUPAC nameN-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]aniline
InChIKeyOWIHKEZYFBVCNY-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)CNC2=CC=CC=C2)Cl)OCC3=CC=CC=C3

Computed by PubChem (NCBI)