Products 124377-60-2

CAS 124377-60-2 is the registry number for 2-(2,6-Dimethylphenoxy)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6-dimethylphenoxy)propanoic acid (CAS 124377-60-2) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(2,6-dimethylphenoxy)propanoic acid. InChIKey: YCBHDWAQGHERIL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3
Molecular weight194.23 g/mol
IUPAC name2-(2,6-dimethylphenoxy)propanoic acid
InChIKeyYCBHDWAQGHERIL-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)OC(C)C(=O)O

Computed by PubChem (NCBI)