CAS 1243852-84-7 is the registry number for 5,8-Dimethoxy-2-naphthalenol Triflate. Offered by: TRC. Available pack sizes: 500mg.
(5,8-dimethoxynaphthalen-2-yl) trifluoromethanesulfonate (CAS 1243852-84-7) is a chemical compound with the molecular formula C13H11F3O5S and a molecular weight of 336.29 g/mol. IUPAC name: (5,8-dimethoxynaphthalen-2-yl) trifluoromethanesulfonate. InChIKey: APFVFPIVYFFJSX-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O5S |
|---|---|
| Molecular weight | 336.29 g/mol |
| IUPAC name | (5,8-dimethoxynaphthalen-2-yl) trifluoromethanesulfonate |
| InChIKey | APFVFPIVYFFJSX-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC(=CC2=C(C=C1)OC)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)