CAS 168643-48-9 is the registry number for 6,7-Dimethoxynaphth-1-yl Trifluoromethanesulfonate. Offered by: TRC. Available pack sizes: 100mg.
(6,7-dimethoxynaphthalen-1-yl) trifluoromethanesulfonate (CAS 168643-48-9) is a chemical compound with the molecular formula C13H11F3O5S and a molecular weight of 336.29 g/mol. IUPAC name: (6,7-dimethoxynaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: HTCQLGVGWZPMRC-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O5S |
|---|---|
| Molecular weight | 336.29 g/mol |
| IUPAC name | (6,7-dimethoxynaphthalen-1-yl) trifluoromethanesulfonate |
| InChIKey | HTCQLGVGWZPMRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)