CAS 1244856-11-8 is the registry number for 2,2,3,3,4,4,4-Heptafluorobutyl perfluoroheptanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,3,3,4,4,4-heptafluorobutyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate (CAS 1244856-11-8) is a chemical compound with the molecular formula C11H2F20O2 and a molecular weight of 546.10 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluorobutyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate. InChIKey: DYCCIPNHHNSTOB-UHFFFAOYSA-N.
| Molecular formula | C11H2F20O2 |
|---|---|
| Molecular weight | 546.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluorobutyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
| InChIKey | DYCCIPNHHNSTOB-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)