CAS 1765-48-6 appears in our catalog under these names: 11-H-Eicosafluoroundecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Eicosafluoro-Undecanoic acid. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 5g, 2g, 10g, 25g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecanoic acid (CAS 1765-48-6) is a chemical compound with the molecular formula C11H2F20O2 and a molecular weight of 546.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecanoic acid. InChIKey: MMYNPHSPRPZSSN-UHFFFAOYSA-N.
| Molecular formula | C11H2F20O2 |
|---|---|
| Molecular weight | 546.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecanoic acid |
| InChIKey | MMYNPHSPRPZSSN-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)