Products 1244949-48-1

CAS 1244949-48-1 appears in our catalog under these names: 4-Bromothiazole-5-carboxylic acid, 95%, 4-bromothiazole-5-carboxylic acid, 4-Bromothiazole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-1,3-thiazole-5-carboxylic acid (CAS 1244949-48-1) is a chemical compound with the molecular formula C4H2BrNO2S and a molecular weight of 208.04 g/mol. IUPAC name: 4-bromo-1,3-thiazole-5-carboxylic acid. InChIKey: GQCIIZJOGXFYNG-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrNO2S
Molecular weight208.04 g/mol
IUPAC name4-bromo-1,3-thiazole-5-carboxylic acid
InChIKeyGQCIIZJOGXFYNG-UHFFFAOYSA-N
SMILESC1=NC(=C(S1)C(=O)O)Br

Computed by PubChem (NCBI)