Products 4576-88-9

CAS 4576-88-9 is the registry number for 4-Bromo-1,2-thiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-bromo-1,2-thiazole-3-carboxylic acid (CAS 4576-88-9) is a chemical compound with the molecular formula C4H2BrNO2S and a molecular weight of 208.04 g/mol. IUPAC name: 4-bromo-1,2-thiazole-3-carboxylic acid. InChIKey: AZXGRLSGOYZQAR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrNO2S
Molecular weight208.04 g/mol
IUPAC name4-bromo-1,2-thiazole-3-carboxylic acid
InChIKeyAZXGRLSGOYZQAR-UHFFFAOYSA-N
SMILESC1=C(C(=NS1)C(=O)O)Br

Computed by PubChem (NCBI)