CAS 1245004-58-3 is the registry number for 5-Methoxy-2H-1,4-benzothiazin-3(4H)-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methoxy-4H-1,4-benzothiazin-3-one (CAS 1245004-58-3) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 5-methoxy-4H-1,4-benzothiazin-3-one. InChIKey: VNQNDJCJXFTIEV-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5-methoxy-4H-1,4-benzothiazin-3-one |
| InChIKey | VNQNDJCJXFTIEV-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC=C1)SCC(=O)N2 |
Computed by PubChem (NCBI)