Products 1245534-33-1
CAS 1245534-33-1 appears in our catalog under these names: Methyl 2-methoxy-4,5-dimethylbenzoate, 95%, Methyl 2-methoxy-4,5-dimethylbenzoate, 95+%, Methyl 2–methoxy–4，5–dimethylbenzoate, Methyl 2-methoxy-4,5-dimethylbenzoate, ≥95%, ≥95%, Methyl 2-methoxy-4,5-dimethylbenzoate, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 2-methoxy-4,5-dimethylbenzoate (CAS 1245534-33-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl 2-methoxy-4,5-dimethylbenzoate. InChIKey: FEKLTHCADUIRNW-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl 2-methoxy-4,5-dimethylbenzoate |
| InChIKey | FEKLTHCADUIRNW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)OC)C(=O)OC |
Computed by PubChem (NCBI)