Products 1245534-96-6

CAS 1245534-96-6 appears in our catalog under these names: 5-Chloro-2-(cyclopentyloxy)benzene-1-sulfonyl chloride, 95%, 5-Chloro-2-(cyclopentyloxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

5-chloro-2-cyclopentyloxybenzenesulfonyl chloride (CAS 1245534-96-6) is a chemical compound with the molecular formula C11H12Cl2O3S and a molecular weight of 295.2 g/mol. IUPAC name: 5-chloro-2-cyclopentyloxybenzenesulfonyl chloride. InChIKey: FWCOWACLOWTUDY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O3S
Molecular weight295.2 g/mol
IUPAC name5-chloro-2-cyclopentyloxybenzenesulfonyl chloride
InChIKeyFWCOWACLOWTUDY-UHFFFAOYSA-N
SMILESC1CCC(C1)OC2=C(C=C(C=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)