Products 1485204-33-8

CAS 1485204-33-8 is the registry number for 5-Chloro-2-(cyclobutylmethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-chloro-2-(cyclobutylmethoxy)benzenesulfonyl chloride (CAS 1485204-33-8) is a chemical compound with the molecular formula C11H12Cl2O3S and a molecular weight of 295.2 g/mol. IUPAC name: 5-chloro-2-(cyclobutylmethoxy)benzenesulfonyl chloride. InChIKey: OJWGNSIOXMZWRC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O3S
Molecular weight295.2 g/mol
IUPAC name5-chloro-2-(cyclobutylmethoxy)benzenesulfonyl chloride
InChIKeyOJWGNSIOXMZWRC-UHFFFAOYSA-N
SMILESC1CC(C1)COC2=C(C=C(C=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)