Products 1245563-14-7

CAS 1245563-14-7 is the registry number for O-5-Bromopyridin-3-yl dimethylcarbamothioate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

O-[(5-bromo-3-pyridinyl)] N,N-dimethylcarbamothioate (CAS 1245563-14-7) is a chemical compound with the molecular formula C8H9BrN2OS and a molecular weight of 261.14 g/mol. IUPAC name: O-[(5-bromo-3-pyridinyl)] N,N-dimethylcarbamothioate. InChIKey: QFYLIIDNTFHXSD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BrN2OS
Molecular weight261.14 g/mol
IUPAC nameO-[(5-bromo-3-pyridinyl)] N,N-dimethylcarbamothioate
InChIKeyQFYLIIDNTFHXSD-UHFFFAOYSA-N
SMILESCN(C)C(=S)OC1=CC(=CN=C1)Br

Computed by PubChem (NCBI)