CAS 877675-06-4 appears in our catalog under these names: 2-Bromo-5-(pyrrolidine-1-carbonyl)-1,3-thiazole, 95%, (2-Bromothiazol-5-yl)(pyrrolidin-1-yl)methanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2-bromo-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone (CAS 877675-06-4) is a chemical compound with the molecular formula C8H9BrN2OS and a molecular weight of 261.14 g/mol. IUPAC name: (2-bromo-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone. InChIKey: HMUWOBBWUFBDJI-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2OS |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (2-bromo-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone |
| InChIKey | HMUWOBBWUFBDJI-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CN=C(S2)Br |
Computed by PubChem (NCBI)