CAS 1245644-68-1 appears in our catalog under these names: 8-chloro-(1,2,4)triazolo(1,5-a)pyridin-2-amine, 8-Chloro[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95+%, 95+%, 8-CHLORO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 500mg, 5g.
8-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1245644-68-1) is a chemical compound with the molecular formula C6H5ClN4 and a molecular weight of 168.58 g/mol. IUPAC name: 8-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: MWSWBCKCTLMDKD-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4 |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 8-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | MWSWBCKCTLMDKD-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)N)C(=C1)Cl |
Computed by PubChem (NCBI)