CAS 1245648-74-1 is the registry number for (Trans-2-(4-methoxyphenyl)pyrrolidin-3-yl)methanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3S)-2-(4-methoxyphenyl)pyrrolidin-3-yl]methanol (CAS 1245648-74-1) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: [(2S,3S)-2-(4-methoxyphenyl)pyrrolidin-3-yl]methanol. InChIKey: MMRCYRSNAOYMIJ-ZYHUDNBSSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | [(2S,3S)-2-(4-methoxyphenyl)pyrrolidin-3-yl]methanol |
| InChIKey | MMRCYRSNAOYMIJ-ZYHUDNBSSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2[C@H](CCN2)CO |
Computed by PubChem (NCBI)