Products 124565-17-9

CAS 124565-17-9 is the registry number for 3,6,9,12-Tetraoxatetradec-1-yl 2-propenoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate (CAS 124565-17-9) is a chemical compound with the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. IUPAC name: 2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate. InChIKey: ZIZXQUSKKWSRBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24O6
Molecular weight276.33 g/mol
IUPAC name2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate
InChIKeyZIZXQUSKKWSRBZ-UHFFFAOYSA-N
SMILESCCOCCOCCOCCOCCOC(=O)C=C

Computed by PubChem (NCBI)