Products 57454-26-9

CAS 57454-26-9 is the registry number for 2,5,8,11-Tetraoxatridecan-13-yl methacrylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (CAS 57454-26-9) is a chemical compound with the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. IUPAC name: 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. InChIKey: KRCGBOKYIUDIFY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24O6
Molecular weight276.33 g/mol
IUPAC name2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate
InChIKeyKRCGBOKYIUDIFY-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCCOCCOCCOCCOC

Computed by PubChem (NCBI)