CAS 1245771-97-4 is the registry number for 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (CAS 1245771-97-4) is a chemical compound with the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide. InChIKey: RGXJDXSOGHNPHB-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3O |
|---|---|
| Molecular weight | 193.13 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| InChIKey | RGXJDXSOGHNPHB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)